C17H23F3N2O2 — CID 119700416
3-piperidin-4-yl-N-[2-(2,2,2-trifluoroethoxy)phenyl]butanamide (PubChem CID 119700416) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[2-(2,2,2-trifluoroethoxy)phenyl]butanamide.
| Compound Name | 3-piperidin-4-yl-N-[2-(2,2,2-trifluoroethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 119700416 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-piperidin-4-yl-N-[2-(2,2,2-trifluoroethoxy)phenyl]butanamide |
| SMILES | CC(CC(=O)Nc1ccccc1OCC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C17H23F3N2O2/c1-12(13-6-8-21-9-7-13)10-16(23)22-14-4-2-3-5-15(14)24-11-17(18,19)20/h2-5,12-13,21H,6-11H2,1H3,(H,22,23) |
| InChIKey | DDOANFMQPHYNET-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |