C24H27N2OS+ — CID 11944114
(2S)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]propanamide (PubChem CID 11944114) has the molecular formula C24H27N2OS+ and a molecular weight of 391.56 g/mol. Its IUPAC name is (2S)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 11944114 |
| Molecular Formula | C24H27N2OS+ |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (2S)-N-benzhydryl-2-[(2R)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC(c1ccccc1)c1ccccc1)[NH+]1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C24H26N2OS/c1-18(26-16-8-14-21(26)22-15-9-17-28-22)24(27)25-23(19-10-4-2-5-11-19)20-12-6-3-7-13-20/h2-7,9-13,15,17-18,21,23H,8,14,16H2,1H3,(H,25,27)/p+1/t18-,21+/m0/s1 |
| InChIKey | YVIXBJHWCKLZMV-GHTZIAJQSA-O |
| XLogP | 3.76 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |