C25H28N6O — CID 11948380
N-[[4-(dimethylamino)phenyl]methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine (PubChem CID 11948380) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
|---|---|
| PubChem CID | 11948380 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(6-methoxy-1,5-naphthyridin-4-yl)-4,5,6,7-tetrahydroindazol-5-amine |
| SMILES | COc1ccc2nccc(-n3cc4c(n3)CCC(NCc3ccc(N(C)C)cc3)C4)c2n1 |
| InChI | InChI=1S/C25H28N6O/c1-30(2)20-7-4-17(5-8-20)15-27-19-6-9-21-18(14-19)16-31(29-21)23-12-13-26-22-10-11-24(32-3)28-25(22)23/h4-5,7-8,10-13,16,19,27H,6,9,14-15H2,1-3H3 |
| InChIKey | AFYIFULNYNIAEI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|