C42H59NO7 — CID 11954582
propyl N-[(2R,4S)-4-[(4R,5R)-2-methoxy-5-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-4-phenylmethoxyoxolan-2-yl]-2-methylpentyl]carbamate (PubChem CID 11954582) has the molecular formula C42H59NO7 and a molecular weight of 689.93 g/mol. Its IUPAC name is propyl N-[(2R,4S)-4-[(4R,5R)-2-methoxy-5-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-4-phenylmethoxyoxolan-2-yl]-2-methylpentyl]carbamate.
| Compound Name | propyl N-[(2R,4S)-4-[(4R,5R)-2-methoxy-5-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-4-phenylmethoxyoxolan-2-yl]-2-methylpentyl]carbamate |
|---|---|
| PubChem CID | 11954582 |
| Molecular Formula | C42H59NO7 |
| Molecular Weight | 689.93 g/mol |
| Exact Mass | 689.43 |
| IUPAC Name | propyl N-[(2R,4S)-4-[(4R,5R)-2-methoxy-5-[(1R,3R)-3-methyl-1,5-bis(phenylmethoxy)pentyl]-4-phenylmethoxyoxolan-2-yl]-2-methylpentyl]carbamate |
| SMILES | CCCOC(=O)NC[C@H](C)C[C@H](C)C1(OC)C[C@@H](OCc2ccccc2)[C@@H]([C@@H](C[C@H](C)CCOCc2ccccc2)OCc2ccccc2)O1 |
| InChI | InChI=1S/C42H59NO7/c1-6-23-47-41(44)43-28-33(3)25-34(4)42(45-5)27-39(49-31-37-20-14-9-15-21-37)40(50-42)38(48-30-36-18-12-8-13-19-36)26-32(2)22-24-46-29-35-16-10-7-11-17-35/h7-21,32-34,38-40H,6,22-31H2,1-5H3,(H,43,44)/t32-,33-,34+,38-,39-,40-,42?/m1/s1 |
| InChIKey | AQNREWNZZSRCJV-WPUZXQFRSA-N |
| XLogP | 8.72 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.93 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|