C18H17F3N2O2S — CID 11976399
(5E)-2-morpholin-4-yl-5-[(Z)-3-[4-(trifluoromethyl)phenyl]but-2-enylidene]-1,3-thiazol-4-one (PubChem CID 11976399) has the molecular formula C18H17F3N2O2S and a molecular weight of 382.41 g/mol. Its IUPAC name is (5E)-2-morpholin-4-yl-5-[(Z)-3-[4-(trifluoromethyl)phenyl]but-2-enylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-morpholin-4-yl-5-[(Z)-3-[4-(trifluoromethyl)phenyl]but-2-enylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11976399 |
| Molecular Formula | C18H17F3N2O2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (5E)-2-morpholin-4-yl-5-[(Z)-3-[4-(trifluoromethyl)phenyl]but-2-enylidene]-1,3-thiazol-4-one |
| SMILES | C/C(=C/C=C1/SC(N2CCOCC2)=NC1=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3N2O2S/c1-12(13-3-5-14(6-4-13)18(19,20)21)2-7-15-16(24)22-17(26-15)23-8-10-25-11-9-23/h2-7H,8-11H2,1H3/b12-2-,15-7+ |
| InChIKey | CJYJBMBQZAMUND-PBVCDCGSSA-N |
| XLogP | 3.95 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|