C21H37NO3Si — CID 11991280
(1S,4R)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-2-enoyl]-4,7,7-trimethyl-2-azabicyclo[2.2.1]heptan-3-one (PubChem CID 11991280) has the molecular formula C21H37NO3Si and a molecular weight of 379.62 g/mol. Its IUPAC name is (1S,4R)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-2-enoyl]-4,7,7-trimethyl-2-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1S,4R)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-2-enoyl]-4,7,7-trimethyl-2-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 11991280 |
| Molecular Formula | C21H37NO3Si |
| Molecular Weight | 379.62 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (1S,4R)-2-[(E,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-2-enoyl]-4,7,7-trimethyl-2-azabicyclo[2.2.1]heptan-3-one |
| SMILES | C/C(=C\[C@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C21H37NO3Si/c1-14(13-15(2)25-26(9,10)19(3,4)5)17(23)22-16-11-12-21(8,18(22)24)20(16,6)7/h13,15-16H,11-12H2,1-10H3/b14-13+/t15-,16-,21-/m0/s1 |
| InChIKey | PNFYCDVDZYWPEE-DYQAYLMESA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|