C11H16N2O5S — CID 119986857
methyl 5-[(2-amino-1-cyclopropylethyl)sulfamoyl]furan-2-carboxylate (PubChem CID 119986857) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl 5-[(2-amino-1-cyclopropylethyl)sulfamoyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2-amino-1-cyclopropylethyl)sulfamoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 119986857 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 5-[(2-amino-1-cyclopropylethyl)sulfamoyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC(CN)C2CC2)o1 |
| InChI | InChI=1S/C11H16N2O5S/c1-17-11(14)9-4-5-10(18-9)19(15,16)13-8(6-12)7-2-3-7/h4-5,7-8,13H,2-3,6,12H2,1H3 |
| InChIKey | JZCYTUOHVDANNZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |