C23H45ISi — CID 12012519
[(5Z,7Z)-6-hexyl-8-iodotetradeca-5,7-dien-5-yl]-trimethylsilane (PubChem CID 12012519) has the molecular formula C23H45ISi and a molecular weight of 476.60 g/mol. Its IUPAC name is [(5Z,7Z)-6-hexyl-8-iodotetradeca-5,7-dien-5-yl]-trimethylsilane.
| Compound Name | [(5Z,7Z)-6-hexyl-8-iodotetradeca-5,7-dien-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 12012519 |
| Molecular Formula | C23H45ISi |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [(5Z,7Z)-6-hexyl-8-iodotetradeca-5,7-dien-5-yl]-trimethylsilane |
| SMILES | CCCCCC/C(I)=C/C(CCCCCC)=C(/CCCC)[Si](C)(C)C |
| InChI | InChI=1S/C23H45ISi/c1-7-10-13-15-17-21(20-22(24)18-16-14-11-8-2)23(19-12-9-3)25(4,5)6/h20H,7-19H2,1-6H3/b22-20-,23-21- |
| InChIKey | CCEMYOAPRLJNOA-YEUCEMRASA-N |
| XLogP | 9.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|