C21H15Cl2N3O2S — CID 1201918
N-[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 1201918) has the molecular formula C21H15Cl2N3O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1201918 |
| Molecular Formula | C21H15Cl2N3O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | N-[5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)S1 |
| InChI | InChI=1S/C21H15Cl2N3O2S/c1-12(27)24-21-25-20(28)19(29-21)8-14-11-26(18-5-3-2-4-16(14)18)10-13-6-7-15(22)9-17(13)23/h2-9,11H,10H2,1H3,(H,24,25,27,28) |
| InChIKey | JOTJXTUQXLFDJK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|