C22H38OSi2 — CID 12036885
3-ethynyl-1-triethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol (PubChem CID 12036885) has the molecular formula C22H38OSi2 and a molecular weight of 374.72 g/mol. Its IUPAC name is 3-ethynyl-1-triethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol.
| Compound Name | 3-ethynyl-1-triethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 12036885 |
| Molecular Formula | C22H38OSi2 |
| Molecular Weight | 374.72 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 3-ethynyl-1-triethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-ol |
| SMILES | C#CC(O)(C#C[Si](CC)(CC)CC)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H38OSi2/c1-11-22(23,15-17-24(12-2,13-3)14-4)16-18-25(19(5)6,20(7)8)21(9)10/h1,19-21,23H,12-14H2,2-10H3 |
| InChIKey | LWEYZCUERCBMBA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|