C33H22O14 — CID 12044932
5,7-diacetyl-6-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-2,3-dihydroxy-9-oxoxanthene-1-carboxylic acid (PubChem CID 12044932) has the molecular formula C33H22O14 and a molecular weight of 642.53 g/mol. Its IUPAC name is 5,7-diacetyl-6-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-2,3-dihydroxy-9-oxoxanthene-1-carboxylic acid.
| Compound Name | 5,7-diacetyl-6-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-2,3-dihydroxy-9-oxoxanthene-1-carboxylic acid |
|---|---|
| PubChem CID | 12044932 |
| Molecular Formula | C33H22O14 |
| Molecular Weight | 642.53 g/mol |
| Exact Mass | 642.10 |
| IUPAC Name | 5,7-diacetyl-6-[3-acetyl-4-hydroxy-5-(2,4,5-trihydroxybenzoyl)phenyl]-2,3-dihydroxy-9-oxoxanthene-1-carboxylic acid |
| SMILES | CC(=O)c1cc(-c2c(C(C)=O)cc3c(=O)c4c(C(=O)O)c(O)c(O)cc4oc3c2C(C)=O)cc(C(=O)c2cc(O)c(O)cc2O)c1O |
| InChI | InChI=1S/C33H22O14/c1-10(34)14-6-18-30(43)26-23(9-22(40)31(44)27(26)33(45)46)47-32(18)24(12(3)36)25(14)13-4-15(11(2)35)28(41)17(5-13)29(42)16-7-20(38)21(39)8-19(16)37/h4-9,37-41,44H,1-3H3,(H,45,46) |
| InChIKey | IWOZCHGELICGNJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 257.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|