C26H16O9 — CID 121435059
2,4-diacetyl-6,7-dihydroxy-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one (PubChem CID 121435059) has the molecular formula C26H16O9 and a molecular weight of 472.41 g/mol. Its IUPAC name is 2,4-diacetyl-6,7-dihydroxy-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one.
| Compound Name | 2,4-diacetyl-6,7-dihydroxy-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one |
|---|---|
| PubChem CID | 121435059 |
| Molecular Formula | C26H16O9 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2,4-diacetyl-6,7-dihydroxy-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one |
| SMILES | CC(=O)c1cc2c(=O)c3cc(O)c(O)cc3oc2c(C(C)=O)c1-c1coc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C26H16O9/c1-10(27)14-6-16-25(33)15-7-18(30)19(31)8-21(15)35-26(16)22(11(2)28)23(14)17-9-34-20-5-12(29)3-4-13(20)24(17)32/h3-9,29-31H,1-2H3 |
| InChIKey | DDCWVHGXXXSCDG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 155.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|