C26H16O7 — CID 121443333
2,4-diacetyl-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one (PubChem CID 121443333) has the molecular formula C26H16O7 and a molecular weight of 440.41 g/mol. Its IUPAC name is 2,4-diacetyl-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one.
| Compound Name | 2,4-diacetyl-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one |
|---|---|
| PubChem CID | 121443333 |
| Molecular Formula | C26H16O7 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 2,4-diacetyl-3-(7-hydroxy-4-oxochromen-3-yl)xanthen-9-one |
| SMILES | CC(=O)c1cc2c(=O)c3ccccc3oc2c(C(C)=O)c1-c1coc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C26H16O7/c1-12(27)17-10-18-24(30)15-5-3-4-6-20(15)33-26(18)22(13(2)28)23(17)19-11-32-21-9-14(29)7-8-16(21)25(19)31/h3-11,29H,1-2H3 |
| InChIKey | RDNPFOGGTGMCBY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|