C30H24O8 — CID 121442082
2,4-diacetyl-3-[7-(methoxymethoxy)-4-oxochromen-3-yl]-6,7-dimethylxanthen-9-one (PubChem CID 121442082) has the molecular formula C30H24O8 and a molecular weight of 512.51 g/mol. Its IUPAC name is 2,4-diacetyl-3-[7-(methoxymethoxy)-4-oxochromen-3-yl]-6,7-dimethylxanthen-9-one.
| Compound Name | 2,4-diacetyl-3-[7-(methoxymethoxy)-4-oxochromen-3-yl]-6,7-dimethylxanthen-9-one |
|---|---|
| PubChem CID | 121442082 |
| Molecular Formula | C30H24O8 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 2,4-diacetyl-3-[7-(methoxymethoxy)-4-oxochromen-3-yl]-6,7-dimethylxanthen-9-one |
| SMILES | COCOc1ccc2c(=O)c(-c3c(C(C)=O)cc4c(=O)c5cc(C)c(C)cc5oc4c3C(C)=O)coc2c1 |
| InChI | InChI=1S/C30H24O8/c1-14-8-21-25(9-15(14)2)38-30-22(29(21)34)11-20(16(3)31)27(26(30)17(4)32)23-12-36-24-10-18(37-13-35-5)6-7-19(24)28(23)33/h6-12H,13H2,1-5H3 |
| InChIKey | RVUCZNFETKEPHH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 113.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|