C28H16O13 — CID 12044925
5,7-diacetyl-6-(5-carboxy-6,7-dihydroxy-4-oxochromen-3-yl)-3-hydroxy-9-oxoxanthene-1-carboxylic acid (PubChem CID 12044925) has the molecular formula C28H16O13 and a molecular weight of 560.42 g/mol. Its IUPAC name is 5,7-diacetyl-6-(5-carboxy-6,7-dihydroxy-4-oxochromen-3-yl)-3-hydroxy-9-oxoxanthene-1-carboxylic acid.
| Compound Name | 5,7-diacetyl-6-(5-carboxy-6,7-dihydroxy-4-oxochromen-3-yl)-3-hydroxy-9-oxoxanthene-1-carboxylic acid |
|---|---|
| PubChem CID | 12044925 |
| Molecular Formula | C28H16O13 |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 5,7-diacetyl-6-(5-carboxy-6,7-dihydroxy-4-oxochromen-3-yl)-3-hydroxy-9-oxoxanthene-1-carboxylic acid |
| SMILES | CC(=O)c1cc2c(=O)c3c(C(=O)O)cc(O)cc3oc2c(C(C)=O)c1-c1coc2cc(O)c(O)c(C(=O)O)c2c1=O |
| InChI | InChI=1S/C28H16O13/c1-8(29)11-5-13-23(33)20-12(27(36)37)3-10(31)4-17(20)41-26(13)18(9(2)30)19(11)14-7-40-16-6-15(32)25(35)22(28(38)39)21(16)24(14)34/h3-7,31-32,35H,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | JURMJMGCBYNXCZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 229.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|