C28H20O8 — CID 121442037
2,4-diacetyl-3-(6,7-dimethyl-4-oxochromen-3-yl)-6,7-dihydroxyxanthen-9-one (PubChem CID 121442037) has the molecular formula C28H20O8 and a molecular weight of 484.46 g/mol. Its IUPAC name is 2,4-diacetyl-3-(6,7-dimethyl-4-oxochromen-3-yl)-6,7-dihydroxyxanthen-9-one.
| Compound Name | 2,4-diacetyl-3-(6,7-dimethyl-4-oxochromen-3-yl)-6,7-dihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 121442037 |
| Molecular Formula | C28H20O8 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2,4-diacetyl-3-(6,7-dimethyl-4-oxochromen-3-yl)-6,7-dihydroxyxanthen-9-one |
| SMILES | CC(=O)c1cc2c(=O)c3cc(O)c(O)cc3oc2c(C(C)=O)c1-c1coc2cc(C)c(C)cc2c1=O |
| InChI | InChI=1S/C28H20O8/c1-11-5-16-22(6-12(11)2)35-10-19(27(16)34)25-15(13(3)29)7-18-26(33)17-8-20(31)21(32)9-23(17)36-28(18)24(25)14(4)30/h5-10,31-32H,1-4H3 |
| InChIKey | YNDWKBVFBJRKQG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|