C27H18O7 — CID 121442057
2,4-diacetyl-6-hydroxy-3-(5-methyl-4-oxochromen-3-yl)xanthen-9-one (PubChem CID 121442057) has the molecular formula C27H18O7 and a molecular weight of 454.43 g/mol. Its IUPAC name is 2,4-diacetyl-6-hydroxy-3-(5-methyl-4-oxochromen-3-yl)xanthen-9-one.
| Compound Name | 2,4-diacetyl-6-hydroxy-3-(5-methyl-4-oxochromen-3-yl)xanthen-9-one |
|---|---|
| PubChem CID | 121442057 |
| Molecular Formula | C27H18O7 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2,4-diacetyl-6-hydroxy-3-(5-methyl-4-oxochromen-3-yl)xanthen-9-one |
| SMILES | CC(=O)c1cc2c(=O)c3ccc(O)cc3oc2c(C(C)=O)c1-c1coc2cccc(C)c2c1=O |
| InChI | InChI=1S/C27H18O7/c1-12-5-4-6-20-22(12)26(32)19(11-33-20)24-17(13(2)28)10-18-25(31)16-8-7-15(30)9-21(16)34-27(18)23(24)14(3)29/h4-11,30H,1-3H3 |
| InChIKey | WDAXADTZYXFGMC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|