About 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid
3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid (PubChem CID 120532448) has the molecular formula C16H19BrN2O5
and a molecular weight of 399.24 g/mol. Its IUPAC name is 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid.
Molecular Properties
| Compound Name | 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid |
| PubChem CID | 120532448 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)c1cc2c(cc1Br)NC(=O)CO2 |
| InChI | InChI=1S/C16H19BrN2O5/c1-3-16(4-2,7-14(21)22)19-15(23)9-5-12-11(6-10(9)17)18-13(20)8-24-12/h5-6H,3-4,7-8H2,1-2H3,(H,18,20)(H,19,23)(H,21,22) |
| InChIKey | URMGAABXBIEDHY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid?
The IUPAC name of 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid (CID 120532448) is 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid.
What is the SMILES notation for 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid?
The canonical SMILES for 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid is CCC(CC)(CC(=O)O)NC(=O)c1cc2c(cc1Br)NC(=O)CO2.
What is the InChIKey of 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid?
The InChIKey is URMGAABXBIEDHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O5/c1-3-16(4-2,7-14(21)22)19-15(23)9-5-12-11(6-10(9)17)18-13(20)8-24-12/h5-6H,3-4,7-8H2,1-2H3,(H,18,20)(H,19,23)(H,21,22).
What are the key properties of 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid?
3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid has a molecular weight of 399.24 g/mol, XLogP of 2.54, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromo-3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]-3-ethylpentanoic acid is sourced from PubChem (CID 120532448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).