C10H17N3O2S — CID 120569626
(4R)-4-(2,3-dimethylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one (PubChem CID 120569626) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is (4R)-4-(2,3-dimethylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one.
| Compound Name | (4R)-4-(2,3-dimethylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 120569626 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (4R)-4-(2,3-dimethylpiperazine-1-carbonyl)-1,3-thiazolidin-2-one |
| SMILES | CC1NCCN(C(=O)[C@@H]2CSC(=O)N2)C1C |
| InChI | InChI=1S/C10H17N3O2S/c1-6-7(2)13(4-3-11-6)9(14)8-5-16-10(15)12-8/h6-8,11H,3-5H2,1-2H3,(H,12,15)/t6?,7?,8-/m0/s1 |
| InChIKey | FKILFXAFXSBTQF-RRQHEKLDSA-N |
| XLogP | 0.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|