C24H29N3O2 — CID 120617194
N-[2-(1H-indol-3-yl)-2-phenylethyl]-4-(methoxymethyl)piperidine-4-carboxamide (PubChem CID 120617194) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)-2-phenylethyl]-4-(methoxymethyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-4-(methoxymethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120617194 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-[2-(1H-indol-3-yl)-2-phenylethyl]-4-(methoxymethyl)piperidine-4-carboxamide |
| SMILES | COCC1(C(=O)NCC(c2ccccc2)c2c[nH]c3ccccc23)CCNCC1 |
| InChI | InChI=1S/C24H29N3O2/c1-29-17-24(11-13-25-14-12-24)23(28)27-15-20(18-7-3-2-4-8-18)21-16-26-22-10-6-5-9-19(21)22/h2-10,16,20,25-26H,11-15,17H2,1H3,(H,27,28) |
| InChIKey | ANPFYZBPWOTGLP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |