C17H21NO6 — CID 12063586
(5-acetyloxy-4-hydroxy-1-methyl-6-oxo-4-phenylpiperidin-3-yl)methyl acetate (PubChem CID 12063586) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is (5-acetyloxy-4-hydroxy-1-methyl-6-oxo-4-phenylpiperidin-3-yl)methyl acetate.
| Compound Name | (5-acetyloxy-4-hydroxy-1-methyl-6-oxo-4-phenylpiperidin-3-yl)methyl acetate |
|---|---|
| PubChem CID | 12063586 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (5-acetyloxy-4-hydroxy-1-methyl-6-oxo-4-phenylpiperidin-3-yl)methyl acetate |
| SMILES | CC(=O)OCC1CN(C)C(=O)C(OC(C)=O)C1(O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO6/c1-11(19)23-10-14-9-18(3)16(21)15(24-12(2)20)17(14,22)13-7-5-4-6-8-13/h4-8,14-15,22H,9-10H2,1-3H3 |
| InChIKey | NYXFWILLMISAGF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |