C9H16F2N4O — CID 120663324
2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-(2,2-difluoroethyl)acetamide (PubChem CID 120663324) has the molecular formula C9H16F2N4O and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-(2,2-difluoroethyl)acetamide.
| Compound Name | 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-(2,2-difluoroethyl)acetamide |
|---|---|
| PubChem CID | 120663324 |
| Molecular Formula | C9H16F2N4O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-[(N-cyclopropyl-N'-methylcarbamimidoyl)amino]-N-(2,2-difluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)NCC(F)F)NC1CC1 |
| InChI | InChI=1S/C9H16F2N4O/c1-12-9(15-6-2-3-6)14-5-8(16)13-4-7(10)11/h6-7H,2-5H2,1H3,(H,13,16)(H2,12,14,15) |
| InChIKey | YBGHJODJHQWXHP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|