C12H18N4S2 — CID 121003275
3-(5-butylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)propan-1-amine (PubChem CID 121003275) has the molecular formula C12H18N4S2 and a molecular weight of 282.44 g/mol. Its IUPAC name is 3-(5-butylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)propan-1-amine.
| Compound Name | 3-(5-butylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 121003275 |
| Molecular Formula | C12H18N4S2 |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-(5-butylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)propan-1-amine |
| SMILES | CCCCSc1ncc2nc(CCCN)sc2n1 |
| InChI | InChI=1S/C12H18N4S2/c1-2-3-7-17-12-14-8-9-11(16-12)18-10(15-9)5-4-6-13/h8H,2-7,13H2,1H3 |
| InChIKey | FXRLYYQITIOSLW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|