C12H25NOS — CID 121012094
S-propan-2-yl N,N-dibutylcarbamothioate (PubChem CID 121012094) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is S-propan-2-yl N,N-dibutylcarbamothioate.
| Compound Name | S-propan-2-yl N,N-dibutylcarbamothioate |
|---|---|
| PubChem CID | 121012094 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | S-propan-2-yl N,N-dibutylcarbamothioate |
| SMILES | CCCCN(CCCC)C(=O)SC(C)C |
| InChI | InChI=1S/C12H25NOS/c1-5-7-9-13(10-8-6-2)12(14)15-11(3)4/h11H,5-10H2,1-4H3 |
| InChIKey | YJBDZSQBZKYXGO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|