C22H33N3O5 — CID 121154021
1-[1-(3,4,5-triethoxybenzoyl)azetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121154021) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-[1-(3,4,5-triethoxybenzoyl)azetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(3,4,5-triethoxybenzoyl)azetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121154021 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-[1-(3,4,5-triethoxybenzoyl)azetidin-3-yl]piperidine-4-carboxamide |
| SMILES | CCOc1cc(C(=O)N2CC(N3CCC(C(N)=O)CC3)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H33N3O5/c1-4-28-18-11-16(12-19(29-5-2)20(18)30-6-3)22(27)25-13-17(14-25)24-9-7-15(8-10-24)21(23)26/h11-12,15,17H,4-10,13-14H2,1-3H3,(H2,23,26) |
| InChIKey | MXIXVBMUPBXZAY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |