C18H23N5O — CID 121187574
N-(4-tert-butylphenyl)-3-(pyrimidin-2-ylamino)azetidine-1-carboxamide (PubChem CID 121187574) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-(pyrimidin-2-ylamino)azetidine-1-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-3-(pyrimidin-2-ylamino)azetidine-1-carboxamide |
|---|---|
| PubChem CID | 121187574 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-(pyrimidin-2-ylamino)azetidine-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)N2CC(Nc3ncccn3)C2)cc1 |
| InChI | InChI=1S/C18H23N5O/c1-18(2,3)13-5-7-14(8-6-13)22-17(24)23-11-15(12-23)21-16-19-9-4-10-20-16/h4-10,15H,11-12H2,1-3H3,(H,22,24)(H,19,20,21) |
| InChIKey | WMTLZOBTFLPVTL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |