C14H16N4O4S — CID 121198954
1-(1,1-dioxothiolan-3-yl)-3-[[3-(furan-2-yl)pyrazin-2-yl]methyl]urea (PubChem CID 121198954) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[[3-(furan-2-yl)pyrazin-2-yl]methyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[[3-(furan-2-yl)pyrazin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 121198954 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[[3-(furan-2-yl)pyrazin-2-yl]methyl]urea |
| SMILES | O=C(NCc1nccnc1-c1ccco1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N4O4S/c19-14(18-10-3-7-23(20,21)9-10)17-8-11-13(16-5-4-15-11)12-2-1-6-22-12/h1-2,4-6,10H,3,7-9H2,(H2,17,18,19) |
| InChIKey | UNOLXWIRRDZGFV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |