C11H12O — CID 121217803
(3E,5E,7E)-8-methyldeca-3,5,7-trien-9-yn-2-one (PubChem CID 121217803) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (3E,5E,7E)-8-methyldeca-3,5,7-trien-9-yn-2-one.
| Compound Name | (3E,5E,7E)-8-methyldeca-3,5,7-trien-9-yn-2-one |
|---|---|
| PubChem CID | 121217803 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3E,5E,7E)-8-methyldeca-3,5,7-trien-9-yn-2-one |
| SMILES | C#C/C(C)=C/C=C/C=C/C(C)=O |
| InChI | InChI=1S/C11H12O/c1-4-10(2)8-6-5-7-9-11(3)12/h1,5-9H,2-3H3/b6-5+,9-7+,10-8+ |
| InChIKey | VBLMTKOYWSXAPN-NRIIQWGUSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|