C36H32O2 — CID 10345746
(3Z,5E,8E,10E,12E,14Z,20Z,22E,24E,27E,29Z)-3,15,20,30-tetramethyldotriaconta-3,5,8,10,12,14,20,22,24,27,29-undecaen-1,16,18,31-tetrayne-7,26-dione (PubChem CID 10345746) has the molecular formula C36H32O2 and a molecular weight of 496.65 g/mol. Its IUPAC name is (3Z,5E,8E,10E,12E,14Z,20Z,22E,24E,27E,29Z)-3,15,20,30-tetramethyldotriaconta-3,5,8,10,12,14,20,22,24,27,29-undecaen-1,16,18,31-tetrayne-7,26-dione.
| Compound Name | (3Z,5E,8E,10E,12E,14Z,20Z,22E,24E,27E,29Z)-3,15,20,30-tetramethyldotriaconta-3,5,8,10,12,14,20,22,24,27,29-undecaen-1,16,18,31-tetrayne-7,26-dione |
|---|---|
| PubChem CID | 10345746 |
| Molecular Formula | C36H32O2 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (3Z,5E,8E,10E,12E,14Z,20Z,22E,24E,27E,29Z)-3,15,20,30-tetramethyldotriaconta-3,5,8,10,12,14,20,22,24,27,29-undecaen-1,16,18,31-tetrayne-7,26-dione |
| SMILES | C#C/C(C)=C\C=C\C(=O)/C=C/C=C/C=C(/C)C#CC#C/C(C)=C\C=C\C=C\C=C\C(=O)/C=C/C=C(/C)C#C |
| InChI | InChI=1S/C36H32O2/c1-7-31(3)25-19-29-35(37)27-15-11-9-10-13-21-33(5)23-17-18-24-34(6)22-14-12-16-28-36(38)30-20-26-32(4)8-2/h1-2,9-16,19-22,25-30H,3-6H3/b11-9+,13-10+,14-12+,27-15+,28-16+,29-19+,30-20+,31-25-,32-26-,33-21-,34-22- |
| InChIKey | SPMDBDODEFMWBJ-GTPZPQCCSA-N |
| XLogP | 7.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|