C17H20FN5O3 — CID 121248655
2-[4-[[5-fluoro-4-(methylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde (PubChem CID 121248655) has the molecular formula C17H20FN5O3 and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-4-(methylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[[5-fluoro-4-(methylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 121248655 |
| Molecular Formula | C17H20FN5O3 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[4-[[5-fluoro-4-(methylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
| SMILES | CNc1nc(Nc2ccc(C3CN(C=O)CCO3)cc2OC)ncc1F |
| InChI | InChI=1S/C17H20FN5O3/c1-19-16-12(18)8-20-17(22-16)21-13-4-3-11(7-14(13)25-2)15-9-23(10-24)5-6-26-15/h3-4,7-8,10,15H,5-6,9H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | WTEDBXOLPMLVBO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|