C17H18ClF2N5O3 — CID 121248668
2-[4-[[5-chloro-4-(methylamino)pyrimidin-2-yl]amino]-3-(difluoromethoxy)phenyl]morpholine-4-carbaldehyde (PubChem CID 121248668) has the molecular formula C17H18ClF2N5O3 and a molecular weight of 413.81 g/mol. Its IUPAC name is 2-[4-[[5-chloro-4-(methylamino)pyrimidin-2-yl]amino]-3-(difluoromethoxy)phenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[[5-chloro-4-(methylamino)pyrimidin-2-yl]amino]-3-(difluoromethoxy)phenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 121248668 |
| Molecular Formula | C17H18ClF2N5O3 |
| Molecular Weight | 413.81 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[4-[[5-chloro-4-(methylamino)pyrimidin-2-yl]amino]-3-(difluoromethoxy)phenyl]morpholine-4-carbaldehyde |
| SMILES | CNc1nc(Nc2ccc(C3CN(C=O)CCO3)cc2OC(F)F)ncc1Cl |
| InChI | InChI=1S/C17H18ClF2N5O3/c1-21-15-11(18)7-22-17(24-15)23-12-3-2-10(6-13(12)28-16(19)20)14-8-25(9-26)4-5-27-14/h2-3,6-7,9,14,16H,4-5,8H2,1H3,(H2,21,22,23,24) |
| InChIKey | BQLNUUYYJSXSEK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|