C19H23ClN4O5 — CID 135359213
2-[4-[[5-chloro-4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde (PubChem CID 135359213) has the molecular formula C19H23ClN4O5 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[4-[[5-chloro-4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[[5-chloro-4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 135359213 |
| Molecular Formula | C19H23ClN4O5 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[4-[[5-chloro-4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
| SMILES | COCCOc1nc(Nc2ccc(C3CN(C=O)CCO3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C19H23ClN4O5/c1-26-7-8-29-18-14(20)10-21-19(23-18)22-15-4-3-13(9-16(15)27-2)17-11-24(12-25)5-6-28-17/h3-4,9-10,12,17H,5-8,11H2,1-2H3,(H,21,22,23) |
| InChIKey | KYKSGTIZMKUEHO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|