C21H26ClN5O3 — CID 121248682
2-[4-[[5-chloro-4-(cyclobutylmethylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde (PubChem CID 121248682) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-[4-[[5-chloro-4-(cyclobutylmethylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[[5-chloro-4-(cyclobutylmethylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 121248682 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[4-[[5-chloro-4-(cyclobutylmethylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
| SMILES | COc1cc(C2CN(C=O)CCO2)ccc1Nc1ncc(Cl)c(NCC2CCC2)n1 |
| InChI | InChI=1S/C21H26ClN5O3/c1-29-18-9-15(19-12-27(13-28)7-8-30-19)5-6-17(18)25-21-24-11-16(22)20(26-21)23-10-14-3-2-4-14/h5-6,9,11,13-14,19H,2-4,7-8,10,12H2,1H3,(H2,23,24,25,26) |
| InChIKey | NISODSOAXZFSRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|