C18H21ClN4O5 — CID 130384840
2-[4-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-2,5-dimethoxyphenyl]morpholine-4-carbaldehyde (PubChem CID 130384840) has the molecular formula C18H21ClN4O5 and a molecular weight of 408.84 g/mol. Its IUPAC name is 2-[4-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-2,5-dimethoxyphenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-2,5-dimethoxyphenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 130384840 |
| Molecular Formula | C18H21ClN4O5 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[4-[(5-chloro-4-methoxypyrimidin-2-yl)amino]-2,5-dimethoxyphenyl]morpholine-4-carbaldehyde |
| SMILES | COc1cc(C2CN(C=O)CCO2)c(OC)cc1Nc1ncc(Cl)c(OC)n1 |
| InChI | InChI=1S/C18H21ClN4O5/c1-25-14-7-13(21-18-20-8-12(19)17(22-18)27-3)15(26-2)6-11(14)16-9-23(10-24)4-5-28-16/h6-8,10,16H,4-5,9H2,1-3H3,(H,20,21,22) |
| InChIKey | FCMVQXJKQILFQC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|