C19H24ClN5O3 — CID 121248693
2-[4-[[5-chloro-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde (PubChem CID 121248693) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-[4-[[5-chloro-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde.
| Compound Name | 2-[4-[[5-chloro-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
|---|---|
| PubChem CID | 121248693 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[4-[[5-chloro-4-(propylamino)pyrimidin-2-yl]amino]-3-methoxyphenyl]morpholine-4-carbaldehyde |
| SMILES | CCCNc1nc(Nc2ccc(C3CN(C=O)CCO3)cc2OC)ncc1Cl |
| InChI | InChI=1S/C19H24ClN5O3/c1-3-6-21-18-14(20)10-22-19(24-18)23-15-5-4-13(9-16(15)27-2)17-11-25(12-26)7-8-28-17/h4-5,9-10,12,17H,3,6-8,11H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | NPFDJRKUBDGFOM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|