C21H12F3N3O3S — CID 121283635
6-nitro-N-[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3-benzothiazole-2-carboxamide (PubChem CID 121283635) has the molecular formula C21H12F3N3O3S and a molecular weight of 443.41 g/mol. Its IUPAC name is 6-nitro-N-[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3-benzothiazole-2-carboxamide.
| Compound Name | 6-nitro-N-[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 121283635 |
| Molecular Formula | C21H12F3N3O3S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 6-nitro-N-[3-[2-(trifluoromethyl)phenyl]phenyl]-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2ccccc2C(F)(F)F)c1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C21H12F3N3O3S/c22-21(23,24)16-7-2-1-6-15(16)12-4-3-5-13(10-12)25-19(28)20-26-17-9-8-14(27(29)30)11-18(17)31-20/h1-11H,(H,25,28) |
| InChIKey | BIVLROZVNAAVRK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|