C22H22N4 — CID 121284949
2,7,12,16-tetramethyl-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1,3,5,7,9,11,13,15,17(20),18-decaene (PubChem CID 121284949) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2,7,12,16-tetramethyl-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1,3,5,7,9,11,13,15,17(20),18-decaene.
| Compound Name | 2,7,12,16-tetramethyl-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1,3,5,7,9,11,13,15,17(20),18-decaene |
|---|---|
| PubChem CID | 121284949 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2,7,12,16-tetramethyl-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1,3,5,7,9,11,13,15,17(20),18-decaene |
| SMILES | Cc1cncc(C)c2ccc([nH]2)c(C)c2ccc([nH]2)c(C)c2nc1C=C2 |
| InChI | InChI=1S/C22H22N4/c1-13-11-23-12-14(2)18-6-8-20(25-18)16(4)22-10-9-21(26-22)15(3)19-7-5-17(13)24-19/h5-12,24,26H,1-4H3/b13-11+,14-12-,17-13-,18-14+,19-15-,20-16+,21-15-,22-16-,23-11+,23-12- |
| InChIKey | XZGHXORUYXXHDL-GOCQYFMJSA-N |
| XLogP | 5.41 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |