C15H22N2O2 — CID 121292910
2-N-(2-methylhexan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 121292910) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-N-(2-methylhexan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 2-N-(2-methylhexan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 121292910 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-N-(2-methylhexan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | CCCCC(C)(C)NC(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C15H22N2O2/c1-4-5-10-15(2,3)17-14(19)12-9-7-6-8-11(12)13(16)18/h6-9H,4-5,10H2,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | VWYSZWIWARUOFI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |