C37H50ClNO6S — CID 121327660
[2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-yl]acetyl]oxymethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 121327660) has the molecular formula C37H50ClNO6S and a molecular weight of 672.33 g/mol. Its IUPAC name is [2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-yl]acetyl]oxymethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-yl]acetyl]oxymethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 121327660 |
| Molecular Formula | C37H50ClNO6S |
| Molecular Weight | 672.33 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | [2-[1-[(1S)-1-(2-chlorophenyl)-2-methoxy-2-oxoethyl]-4-sulfanylpiperidin-3-yl]acetyl]oxymethyl (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCOC(=O)CC1CN([C@H](C(=O)OC)c2ccccc2Cl)CCC1S |
| InChI | InChI=1S/C37H50ClNO6S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-34(40)44-29-45-35(41)27-30-28-39(26-25-33(30)46)36(37(42)43-2)31-22-20-21-23-32(31)38/h4-5,7-8,10-11,13-14,16-17,20-23,30,33,36,46H,3,6,9,12,15,18-19,24-29H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-/t30?,33?,36-/m0/s1 |
| InChIKey | WUWDSONKWLRDDR-UNTFXKLTSA-N |
| XLogP | 8.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.33 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|