C41H79NO3 — CID 121330821
[(9Z,26Z)-37-(dimethylamino)-34-methylheptatriaconta-9,26-dien-18-yl] hydrogen carbonate (PubChem CID 121330821) has the molecular formula C41H79NO3 and a molecular weight of 634.09 g/mol. Its IUPAC name is [(9Z,26Z)-37-(dimethylamino)-34-methylheptatriaconta-9,26-dien-18-yl] hydrogen carbonate.
| Compound Name | [(9Z,26Z)-37-(dimethylamino)-34-methylheptatriaconta-9,26-dien-18-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330821 |
| Molecular Formula | C41H79NO3 |
| Molecular Weight | 634.09 g/mol |
| Exact Mass | 633.61 |
| IUPAC Name | [(9Z,26Z)-37-(dimethylamino)-34-methylheptatriaconta-9,26-dien-18-yl] hydrogen carbonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(CCCCCCC/C=C\CCCCCCC(C)CCCN(C)C)OC(=O)O |
| InChI | InChI=1S/C41H79NO3/c1-5-6-7-8-9-10-11-12-13-16-19-22-25-28-31-36-40(45-41(43)44)37-32-29-26-23-20-17-14-15-18-21-24-27-30-34-39(2)35-33-38-42(3)4/h12-15,39-40H,5-11,16-38H2,1-4H3,(H,43,44)/b13-12-,15-14- |
| InChIKey | XMAPBFQUFHGUMZ-ZJQKOVPWSA-N |
| XLogP | 13.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.09 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|