C34H65NO3 — CID 121330867
[1-(dimethylamino)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate (PubChem CID 121330867) has the molecular formula C34H65NO3 and a molecular weight of 535.90 g/mol. Its IUPAC name is [1-(dimethylamino)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate.
| Compound Name | [1-(dimethylamino)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330867 |
| Molecular Formula | C34H65NO3 |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 535.50 |
| IUPAC Name | [1-(dimethylamino)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CCCCCCCCC(C)CCCN(C)C)OC(=O)O |
| InChI | InChI=1S/C34H65NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-29-33(38-34(36)37)30-25-22-19-18-20-23-27-32(2)28-26-31-35(3)4/h9-10,12-13,32-33H,5-8,11,14-31H2,1-4H3,(H,36,37) |
| InChIKey | YJAQIFPLEPPVGM-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|