C14H24NO10P — CID 121349217
(2S,3R,4S,5R,6R)-6-(methoxymethyl)oxane-2,3,4,5-tetrol;(4-methoxyphenoxy)phosphonamidic acid (PubChem CID 121349217) has the molecular formula C14H24NO10P and a molecular weight of 397.32 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-(methoxymethyl)oxane-2,3,4,5-tetrol;(4-methoxyphenoxy)phosphonamidic acid.
| Compound Name | (2S,3R,4S,5R,6R)-6-(methoxymethyl)oxane-2,3,4,5-tetrol;(4-methoxyphenoxy)phosphonamidic acid |
|---|---|
| PubChem CID | 121349217 |
| Molecular Formula | C14H24NO10P |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-(methoxymethyl)oxane-2,3,4,5-tetrol;(4-methoxyphenoxy)phosphonamidic acid |
| SMILES | COC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O.COc1ccc(OP(N)(=O)O)cc1 |
| InChI | InChI=1S/C7H10NO4P.C7H14O6/c1-11-6-2-4-7(5-3-6)12-13(8,9)10;1-12-2-3-4(8)5(9)6(10)7(11)13-3/h2-5H,1H3,(H3,8,9,10);3-11H,2H2,1H3/t;3-,4+,5+,6-,7+/m.1/s1 |
| InChIKey | KPWWFOGHMJMBJI-UTOGPNFYSA-N |
| XLogP | -1.43 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|