C18H22N6O2 — CID 121352223
5-N,5-N-dimethyl-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide (PubChem CID 121352223) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-N,5-N-dimethyl-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide.
| Compound Name | 5-N,5-N-dimethyl-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121352223 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 5-N,5-N-dimethyl-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-5,8-dicarboxamide |
| SMILES | CN(C)C(=O)C1C=CC2=C(N1)N(C(=O)Nc1ccccn1)C1CCN2C1 |
| InChI | InChI=1S/C18H22N6O2/c1-22(2)17(25)13-6-7-14-16(20-13)24(12-8-10-23(14)11-12)18(26)21-15-5-3-4-9-19-15/h3-7,9,12-13,20H,8,10-11H2,1-2H3,(H,19,21,26) |
| InChIKey | VUBIWPZFRGFZHK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |