C18H28N2O4S — CID 121366566
N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-(4-phenylbutanoylamino)-3-sulfanylbutanamide (PubChem CID 121366566) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-(4-phenylbutanoylamino)-3-sulfanylbutanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-(4-phenylbutanoylamino)-3-sulfanylbutanamide |
|---|---|
| PubChem CID | 121366566 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-methyl-2-(4-phenylbutanoylamino)-3-sulfanylbutanamide |
| SMILES | CC(C)(S)C(NC(=O)CCCc1ccccc1)C(=O)NC(CO)CO |
| InChI | InChI=1S/C18H28N2O4S/c1-18(2,25)16(17(24)19-14(11-21)12-22)20-15(23)10-6-9-13-7-4-3-5-8-13/h3-5,7-8,14,16,21-22,25H,6,9-12H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | YZMJRNYTDDZCPX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|