C11H17F8NO — CID 121403368
2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexan-1-amine (PubChem CID 121403368) has the molecular formula C11H17F8NO and a molecular weight of 331.25 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexan-1-amine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexan-1-amine |
|---|---|
| PubChem CID | 121403368 |
| Molecular Formula | C11H17F8NO |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-6-pentoxyhexan-1-amine |
| SMILES | CCCCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CN |
| InChI | InChI=1S/C11H17F8NO/c1-2-3-4-5-21-7-9(14,15)11(18,19)10(16,17)8(12,13)6-20/h2-7,20H2,1H3 |
| InChIKey | DWPAPJYVEMMEJS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|