C34H33N5O8 — CID 121403733
[2-ethyl-5-(3-isocyanato-4-methylanilino)-2-[(3-isocyanato-4-methylphenyl)carbamoyloxymethyl]-5-oxopentyl] 3-isocyanato-5-methylbenzoate (PubChem CID 121403733) has the molecular formula C34H33N5O8 and a molecular weight of 639.67 g/mol. Its IUPAC name is [2-ethyl-5-(3-isocyanato-4-methylanilino)-2-[(3-isocyanato-4-methylphenyl)carbamoyloxymethyl]-5-oxopentyl] 3-isocyanato-5-methylbenzoate.
| Compound Name | [2-ethyl-5-(3-isocyanato-4-methylanilino)-2-[(3-isocyanato-4-methylphenyl)carbamoyloxymethyl]-5-oxopentyl] 3-isocyanato-5-methylbenzoate |
|---|---|
| PubChem CID | 121403733 |
| Molecular Formula | C34H33N5O8 |
| Molecular Weight | 639.67 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | [2-ethyl-5-(3-isocyanato-4-methylanilino)-2-[(3-isocyanato-4-methylphenyl)carbamoyloxymethyl]-5-oxopentyl] 3-isocyanato-5-methylbenzoate |
| SMILES | CCC(CCC(=O)Nc1ccc(C)c(N=C=O)c1)(COC(=O)Nc1ccc(C)c(N=C=O)c1)COC(=O)c1cc(C)cc(N=C=O)c1 |
| InChI | InChI=1S/C34H33N5O8/c1-5-34(17-46-32(44)25-12-22(2)13-28(14-25)35-19-40,11-10-31(43)38-26-8-6-23(3)29(15-26)36-20-41)18-47-33(45)39-27-9-7-24(4)30(16-27)37-21-42/h6-9,12-16H,5,10-11,17-18H2,1-4H3,(H,38,43)(H,39,45) |
| InChIKey | DIZJKAGUQHTIDN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 182.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|