C33H32N6O9 — CID 21307361
2,2-bis[(4-isocyanato-3-methylphenyl)carbamoyloxymethyl]butyl N-(4-isocyanato-3-methylphenyl)carbamate (PubChem CID 21307361) has the molecular formula C33H32N6O9 and a molecular weight of 656.65 g/mol. Its IUPAC name is 2,2-bis[(4-isocyanato-3-methylphenyl)carbamoyloxymethyl]butyl N-(4-isocyanato-3-methylphenyl)carbamate.
| Compound Name | 2,2-bis[(4-isocyanato-3-methylphenyl)carbamoyloxymethyl]butyl N-(4-isocyanato-3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 21307361 |
| Molecular Formula | C33H32N6O9 |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.22 |
| IUPAC Name | 2,2-bis[(4-isocyanato-3-methylphenyl)carbamoyloxymethyl]butyl N-(4-isocyanato-3-methylphenyl)carbamate |
| SMILES | CCC(COC(=O)Nc1ccc(N=C=O)c(C)c1)(COC(=O)Nc1ccc(N=C=O)c(C)c1)COC(=O)Nc1ccc(N=C=O)c(C)c1 |
| InChI | InChI=1S/C33H32N6O9/c1-5-33(15-46-30(43)37-24-6-9-27(34-18-40)21(2)12-24,16-47-31(44)38-25-7-10-28(35-19-41)22(3)13-25)17-48-32(45)39-26-8-11-29(36-20-42)23(4)14-26/h6-14H,5,15-17H2,1-4H3,(H,37,43)(H,38,44)(H,39,45) |
| InChIKey | ARQXFQUCELINHR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 203.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|