C13H16N2O2 — CID 123402107
3-(3-isocyanato-4-methylanilino)-2,2-dimethylpropanal (PubChem CID 123402107) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-(3-isocyanato-4-methylanilino)-2,2-dimethylpropanal.
| Compound Name | 3-(3-isocyanato-4-methylanilino)-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 123402107 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-(3-isocyanato-4-methylanilino)-2,2-dimethylpropanal |
| SMILES | Cc1ccc(NCC(C)(C)C=O)cc1N=C=O |
| InChI | InChI=1S/C13H16N2O2/c1-10-4-5-11(6-12(10)15-9-17)14-7-13(2,3)8-16/h4-6,8,14H,7H2,1-3H3 |
| InChIKey | NQLCVLLFPFXWNZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|