C28H27F2NO3 — CID 121410021
2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-fluorophenyl)-4-methyl-2H-chromen-8-ol (PubChem CID 121410021) has the molecular formula C28H27F2NO3 and a molecular weight of 463.52 g/mol. Its IUPAC name is 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-fluorophenyl)-4-methyl-2H-chromen-8-ol.
| Compound Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-fluorophenyl)-4-methyl-2H-chromen-8-ol |
|---|---|
| PubChem CID | 121410021 |
| Molecular Formula | C28H27F2NO3 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-fluorophenyl)-4-methyl-2H-chromen-8-ol |
| SMILES | CC1=C(c2cccc(F)c2)C(c2ccc(OCCN3CC(CF)C3)cc2)Oc2c(O)cccc21 |
| InChI | InChI=1S/C28H27F2NO3/c1-18-24-6-3-7-25(32)28(24)34-27(26(18)21-4-2-5-22(30)14-21)20-8-10-23(11-9-20)33-13-12-31-16-19(15-29)17-31/h2-11,14,19,27,32H,12-13,15-17H2,1H3 |
| InChIKey | AINNXWFNTVIRJE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|