C34H51NO4 — CID 121419180
[(2E)-4-[[(4S)-2,6-dimethyl-3-oxoheptan-4-yl]amino]penta-2,4-dienoyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 121419180) has the molecular formula C34H51NO4 and a molecular weight of 537.79 g/mol. Its IUPAC name is [(2E)-4-[[(4S)-2,6-dimethyl-3-oxoheptan-4-yl]amino]penta-2,4-dienoyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(2E)-4-[[(4S)-2,6-dimethyl-3-oxoheptan-4-yl]amino]penta-2,4-dienoyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 121419180 |
| Molecular Formula | C34H51NO4 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | [(2E)-4-[[(4S)-2,6-dimethyl-3-oxoheptan-4-yl]amino]penta-2,4-dienoyl] (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | C=C(/C=C/C(=O)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)N[C@@H](CC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C34H51NO4/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-32(36)39-33(37)26-25-30(6)35-31(27-28(2)3)34(38)29(4)5/h8-9,11-12,14-15,17-18,20-21,25-26,28-29,31,35H,6-7,10,13,16,19,22-24,27H2,1-5H3/b9-8-,12-11-,15-14-,18-17-,21-20-,26-25+/t31-/m0/s1 |
| InChIKey | QRFVRZMFBDSRRA-UFUGBXOJSA-N |
| XLogP | 8.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|